C28H29ClN2O8 — CID 45260689
methyl 2-(4-aminophenyl)-6,7-dimethoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride (PubChem CID 45260689) has the molecular formula C28H29ClN2O8 and a molecular weight of 557.00 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-6,7-dimethoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-6,7-dimethoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 45260689 |
| Molecular Formula | C28H29ClN2O8 |
| Molecular Weight | 557.00 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | methyl 2-(4-aminophenyl)-6,7-dimethoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2cc(OC)c(OC)cc2c(=O)n1-c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C28H28N2O8.ClH/c1-33-20-13-18-19(14-21(20)34-2)27(31)30(17-9-7-16(29)8-10-17)25(28(32)38-6)24(18)15-11-22(35-3)26(37-5)23(12-15)36-4;/h7-14H,29H2,1-6H3;1H |
| InChIKey | FMKVVGVAIYUICJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.00 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|