About 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride
3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 45260757) has the molecular formula C10H17ClN2O3
and a molecular weight of 248.71 g/mol. Its IUPAC name is 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride |
| PubChem CID | 45260757 |
| Molecular Formula | C10H17ClN2O3 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | CCN1C(=O)OC2(CCN(C)CC2)C1=O.Cl |
| InChI | InChI=1S/C10H16N2O3.ClH/c1-3-12-8(13)10(15-9(12)14)4-6-11(2)7-5-10;/h3-7H2,1-2H3;1H |
| InChIKey | LUZFJFYYCHHGIC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride?
The IUPAC name of 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride (CID 45260757) is 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride.
What is the SMILES notation for 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride?
The canonical SMILES for 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride is CCN1C(=O)OC2(CCN(C)CC2)C1=O.Cl.
What is the InChIKey of 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride?
The InChIKey is LUZFJFYYCHHGIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3.ClH/c1-3-12-8(13)10(15-9(12)14)4-6-11(2)7-5-10;/h3-7H2,1-2H3;1H.
What are the key properties of 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride?
3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride has a molecular weight of 248.71 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione;hydrochloride is sourced from PubChem (CID 45260757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).