C32H43ClN2O2 — CID 45260767
4-[6-(4-benzhydrylpiperazin-1-yl)hexoxy]-2,3,6-trimethylphenol;hydrochloride (PubChem CID 45260767) has the molecular formula C32H43ClN2O2 and a molecular weight of 523.16 g/mol. Its IUPAC name is 4-[6-(4-benzhydrylpiperazin-1-yl)hexoxy]-2,3,6-trimethylphenol;hydrochloride.
| Compound Name | 4-[6-(4-benzhydrylpiperazin-1-yl)hexoxy]-2,3,6-trimethylphenol;hydrochloride |
|---|---|
| PubChem CID | 45260767 |
| Molecular Formula | C32H43ClN2O2 |
| Molecular Weight | 523.16 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 4-[6-(4-benzhydrylpiperazin-1-yl)hexoxy]-2,3,6-trimethylphenol;hydrochloride |
| SMILES | Cc1cc(OCCCCCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c(C)c(C)c1O.Cl |
| InChI | InChI=1S/C32H42N2O2.ClH/c1-25-24-30(26(2)27(3)32(25)35)36-23-13-5-4-12-18-33-19-21-34(22-20-33)31(28-14-8-6-9-15-28)29-16-10-7-11-17-29;/h6-11,14-17,24,31,35H,4-5,12-13,18-23H2,1-3H3;1H |
| InChIKey | ZNTYLJIMOSKMQO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.16 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|