C32H32ClN3O12 — CID 45260802
[(2S,4S)-4-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-2,5,12-trihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl N-(4-nitrophenyl)carbamate;hydrochloride (PubChem CID 45260802) has the molecular formula C32H32ClN3O12 and a molecular weight of 686.07 g/mol. Its IUPAC name is [(2S,4S)-4-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-2,5,12-trihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl N-(4-nitrophenyl)carbamate;hydrochloride.
| Compound Name | [(2S,4S)-4-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-2,5,12-trihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl N-(4-nitrophenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 45260802 |
| Molecular Formula | C32H32ClN3O12 |
| Molecular Weight | 686.07 g/mol |
| Exact Mass | 685.17 |
| IUPAC Name | [(2S,4S)-4-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-2,5,12-trihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]methyl N-(4-nitrophenyl)carbamate;hydrochloride |
| SMILES | CC1OC(O[C@H]2C[C@](O)(COC(=O)Nc3ccc([N+](=O)[O-])cc3)Cc3c(O)c4c(c(O)c32)C(=O)c2ccccc2C4=O)CC(N)C1O.Cl |
| InChI | InChI=1S/C32H31N3O12.ClH/c1-14-26(36)20(33)10-22(46-14)47-21-12-32(42,13-45-31(41)34-15-6-8-16(9-7-15)35(43)44)11-19-23(21)30(40)25-24(29(19)39)27(37)17-4-2-3-5-18(17)28(25)38;/h2-9,14,20-22,26,36,39-40,42H,10-13,33H2,1H3,(H,34,41);1H/t14?,20?,21-,22?,26?,32-;/m0./s1 |
| InChIKey | PRZFGSRIUDGMEC-UUZMBWBYSA-N |
| XLogP | 3.01 |
| TPSA | 241.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.07 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|