C31H29ClN4O7 — CID 45260807
methyl 7-(4-aminophenyl)-8-oxo-2-(pyridin-2-ylmethoxy)-5-(3,4,5-trimethoxyphenyl)-1,7-naphthyridine-6-carboxylate;hydrochloride (PubChem CID 45260807) has the molecular formula C31H29ClN4O7 and a molecular weight of 605.05 g/mol. Its IUPAC name is methyl 7-(4-aminophenyl)-8-oxo-2-(pyridin-2-ylmethoxy)-5-(3,4,5-trimethoxyphenyl)-1,7-naphthyridine-6-carboxylate;hydrochloride.
| Compound Name | methyl 7-(4-aminophenyl)-8-oxo-2-(pyridin-2-ylmethoxy)-5-(3,4,5-trimethoxyphenyl)-1,7-naphthyridine-6-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 45260807 |
| Molecular Formula | C31H29ClN4O7 |
| Molecular Weight | 605.05 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | methyl 7-(4-aminophenyl)-8-oxo-2-(pyridin-2-ylmethoxy)-5-(3,4,5-trimethoxyphenyl)-1,7-naphthyridine-6-carboxylate;hydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2ccc(OCc3ccccn3)nc2c(=O)n1-c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C31H28N4O7.ClH/c1-38-23-15-18(16-24(39-2)29(23)40-3)26-22-12-13-25(42-17-20-7-5-6-14-33-20)34-27(22)30(36)35(28(26)31(37)41-4)21-10-8-19(32)9-11-21;/h5-16H,17,32H2,1-4H3;1H |
| InChIKey | XOIYPORDLDIDPY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.05 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|