About 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride
4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride (PubChem CID 45260814) has the molecular formula C28H35ClN2O2
and a molecular weight of 467.05 g/mol. Its IUPAC name is 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride.
Molecular Properties
| Compound Name | 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride |
| PubChem CID | 45260814 |
| Molecular Formula | C28H35ClN2O2 |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride |
| SMILES | Cc1cc(OCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c(C)c(C)c1O.Cl |
| InChI | InChI=1S/C28H34N2O2.ClH/c1-21-20-26(22(2)23(3)28(21)31)32-19-18-29-14-16-30(17-15-29)27(24-10-6-4-7-11-24)25-12-8-5-9-13-25;/h4-13,20,27,31H,14-19H2,1-3H3;1H |
| InChIKey | GFSYUVKFQCKJNR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride?
The IUPAC name of 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride (CID 45260814) is 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride.
What is the SMILES notation for 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride?
The canonical SMILES for 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride is Cc1cc(OCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c(C)c(C)c1O.Cl.
What is the InChIKey of 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride?
The InChIKey is GFSYUVKFQCKJNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N2O2.ClH/c1-21-20-26(22(2)23(3)28(21)31)32-19-18-29-14-16-30(17-15-29)27(24-10-6-4-7-11-24)25-12-8-5-9-13-25;/h4-13,20,27,31H,14-19H2,1-3H3;1H.
What are the key properties of 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride?
4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride has a molecular weight of 467.05 g/mol, XLogP of 5.53, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]-2,3,6-trimethylphenol;hydrochloride is sourced from PubChem (CID 45260814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).