C13H25ClN8O3S — CID 45260825
(3S)-3-amino-6-(carbamothioylamino)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-N-methylhexanamide;hydrochloride (PubChem CID 45260825) has the molecular formula C13H25ClN8O3S and a molecular weight of 408.92 g/mol. Its IUPAC name is (3S)-3-amino-6-(carbamothioylamino)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-N-methylhexanamide;hydrochloride.
| Compound Name | (3S)-3-amino-6-(carbamothioylamino)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-N-methylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 45260825 |
| Molecular Formula | C13H25ClN8O3S |
| Molecular Weight | 408.92 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (3S)-3-amino-6-(carbamothioylamino)-N-[2-(carbamoylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl]-N-methylhexanamide;hydrochloride |
| SMILES | CN(C(=O)C[C@@H](N)CCCNC(N)=S)C1CN=C(NC(N)=O)NC1=O.Cl |
| InChI | InChI=1S/C13H24N8O3S.ClH/c1-21(8-6-18-13(19-10(8)23)20-11(15)24)9(22)5-7(14)3-2-4-17-12(16)25;/h7-8H,2-6,14H2,1H3,(H3,16,17,25)(H4,15,18,19,20,23,24);1H/t7-,8?;/m0./s1 |
| InChIKey | SBEFVKNXCCXRMJ-JPPWUZRISA-N |
| XLogP | -2.28 |
| TPSA | 180.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.92 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|