About N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide
N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide (PubChem CID 45260871) has the molecular formula C10H17BrN2O3S
and a molecular weight of 325.23 g/mol. Its IUPAC name is N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide.
Molecular Properties
| Compound Name | N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide |
| PubChem CID | 45260871 |
| Molecular Formula | C10H17BrN2O3S |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide |
| SMILES | Br.CNCCc1ccc(O)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C10H16N2O3S.BrH/c1-11-6-5-8-3-4-10(13)9(7-8)12-16(2,14)15;/h3-4,7,11-13H,5-6H2,1-2H3;1H |
| InChIKey | NTIYQDYMVRYSHZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide?
The IUPAC name of N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide (CID 45260871) is N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide.
What is the SMILES notation for N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide?
The canonical SMILES for N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide is Br.CNCCc1ccc(O)c(NS(C)(=O)=O)c1.
What is the InChIKey of N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide?
The InChIKey is NTIYQDYMVRYSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3S.BrH/c1-11-6-5-8-3-4-10(13)9(7-8)12-16(2,14)15;/h3-4,7,11-13H,5-6H2,1-2H3;1H.
What are the key properties of N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide?
N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide has a molecular weight of 325.23 g/mol, XLogP of 1.10, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-hydroxy-5-[2-(methylamino)ethyl]phenyl]methanesulfonamide;hydrobromide is sourced from PubChem (CID 45260871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).