About 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide
4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide (PubChem CID 45260919) has the molecular formula C15H19BrN2O2
and a molecular weight of 339.23 g/mol. Its IUPAC name is 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide.
Molecular Properties
| Compound Name | 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide |
| PubChem CID | 45260919 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide |
| SMILES | Br.O=c1[nH]oc(C2CCNCC2)c1Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2O2.BrH/c18-15-13(10-11-4-2-1-3-5-11)14(19-17-15)12-6-8-16-9-7-12;/h1-5,12,16H,6-10H2,(H,17,18);1H |
| InChIKey | UYADEYSJFRESSA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide?
The IUPAC name of 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide (CID 45260919) is 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide.
What is the SMILES notation for 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide?
The canonical SMILES for 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide is Br.O=c1[nH]oc(C2CCNCC2)c1Cc1ccccc1.
What is the InChIKey of 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide?
The InChIKey is UYADEYSJFRESSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2.BrH/c18-15-13(10-11-4-2-1-3-5-11)14(19-17-15)12-6-8-16-9-7-12;/h1-5,12,16H,6-10H2,(H,17,18);1H.
What are the key properties of 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide?
4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide has a molecular weight of 339.23 g/mol, XLogP of 2.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-5-piperidin-4-yl-1,2-oxazol-3-one;hydrobromide is sourced from PubChem (CID 45260919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).