About 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide
2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide (PubChem CID 45261185) has the molecular formula C9H13Br2FN2O
and a molecular weight of 344.02 g/mol. Its IUPAC name is 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide.
Molecular Properties
| Compound Name | 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide |
| PubChem CID | 45261185 |
| Molecular Formula | C9H13Br2FN2O |
| Molecular Weight | 344.02 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide |
| SMILES | Br.Br.N/C(CF)=N/c1cccc(CO)c1 |
| InChI | InChI=1S/C9H11FN2O.2BrH/c10-5-9(11)12-8-3-1-2-7(4-8)6-13;;/h1-4,13H,5-6H2,(H2,11,12);2*1H |
| InChIKey | INZANJMSQUQVRU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.02 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide?
The IUPAC name of 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide (CID 45261185) is 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide.
What is the SMILES notation for 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide?
The canonical SMILES for 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide is Br.Br.N/C(CF)=N/c1cccc(CO)c1.
What is the InChIKey of 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide?
The InChIKey is INZANJMSQUQVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O.2BrH/c10-5-9(11)12-8-3-1-2-7(4-8)6-13;;/h1-4,13H,5-6H2,(H2,11,12);2*1H.
What are the key properties of 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide?
2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide has a molecular weight of 344.02 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-[3-(hydroxymethyl)phenyl]ethanimidamide;dihydrobromide is sourced from PubChem (CID 45261185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).