About 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride
2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride (PubChem CID 45261251) has the molecular formula C19H28ClN5O2
and a molecular weight of 393.92 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride |
| PubChem CID | 45261251 |
| Molecular Formula | C19H28ClN5O2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)C1(c2ccc(-n3cnnn3)cc2)CCCC1.Cl |
| InChI | InChI=1S/C19H27N5O2.ClH/c1-3-23(4-2)13-14-26-18(25)19(11-5-6-12-19)16-7-9-17(10-8-16)24-15-20-21-22-24;/h7-10,15H,3-6,11-14H2,1-2H3;1H |
| InChIKey | CIJKNSKFLKAZIG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride (CID 45261251) is 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride is CCN(CC)CCOC(=O)C1(c2ccc(-n3cnnn3)cc2)CCCC1.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride?
The InChIKey is CIJKNSKFLKAZIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N5O2.ClH/c1-3-23(4-2)13-14-26-18(25)19(11-5-6-12-19)16-7-9-17(10-8-16)24-15-20-21-22-24;/h7-10,15H,3-6,11-14H2,1-2H3;1H.
What are the key properties of 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride?
2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride has a molecular weight of 393.92 g/mol, XLogP of 2.78, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 1-[4-(tetrazol-1-yl)phenyl]cyclopentane-1-carboxylate;hydrochloride is sourced from PubChem (CID 45261251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).