C20H32ClNO2 — CID 45261392
(1R,3S)-3-cyclohexyl-6-methyl-1-(propylaminomethyl)-3,4-dihydro-1H-isochromen-5-ol;hydrochloride (PubChem CID 45261392) has the molecular formula C20H32ClNO2 and a molecular weight of 353.93 g/mol. Its IUPAC name is (1R,3S)-3-cyclohexyl-6-methyl-1-(propylaminomethyl)-3,4-dihydro-1H-isochromen-5-ol;hydrochloride.
| Compound Name | (1R,3S)-3-cyclohexyl-6-methyl-1-(propylaminomethyl)-3,4-dihydro-1H-isochromen-5-ol;hydrochloride |
|---|---|
| PubChem CID | 45261392 |
| Molecular Formula | C20H32ClNO2 |
| Molecular Weight | 353.93 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (1R,3S)-3-cyclohexyl-6-methyl-1-(propylaminomethyl)-3,4-dihydro-1H-isochromen-5-ol;hydrochloride |
| SMILES | CCCNC[C@@H]1O[C@H](C2CCCCC2)Cc2c1ccc(C)c2O.Cl |
| InChI | InChI=1S/C20H31NO2.ClH/c1-3-11-21-13-19-16-10-9-14(2)20(22)17(16)12-18(23-19)15-7-5-4-6-8-15;/h9-10,15,18-19,21-22H,3-8,11-13H2,1-2H3;1H/t18-,19-;/m0./s1 |
| InChIKey | MPIJKUZSDZWJDR-HLRBRJAUSA-N |
| XLogP | 4.68 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|