C14H22ClN5O2S — CID 45261491
2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(propylsulfanylmethyl)pyrrolidine-3,4-diol;hydrochloride (PubChem CID 45261491) has the molecular formula C14H22ClN5O2S and a molecular weight of 359.88 g/mol. Its IUPAC name is 2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(propylsulfanylmethyl)pyrrolidine-3,4-diol;hydrochloride.
| Compound Name | 2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(propylsulfanylmethyl)pyrrolidine-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 45261491 |
| Molecular Formula | C14H22ClN5O2S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(propylsulfanylmethyl)pyrrolidine-3,4-diol;hydrochloride |
| SMILES | CCCSCC1NC(c2c[nH]c3c(N)ncnc23)C(O)C1O.Cl |
| InChI | InChI=1S/C14H21N5O2S.ClH/c1-2-3-22-5-8-12(20)13(21)10(19-8)7-4-16-11-9(7)17-6-18-14(11)15;/h4,6,8,10,12-13,16,19-21H,2-3,5H2,1H3,(H2,15,17,18);1H |
| InChIKey | UEPZRWWSDWFCLO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|