About (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride
(1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride (PubChem CID 45261492) has the molecular formula C13H19ClN2O
and a molecular weight of 254.76 g/mol. Its IUPAC name is (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride |
| PubChem CID | 45261492 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride |
| SMILES | CN(C)C(=O)[C@]1(c2ccccc2)CC1CN.Cl |
| InChI | InChI=1S/C13H18N2O.ClH/c1-15(2)12(16)13(8-11(13)9-14)10-6-4-3-5-7-10;/h3-7,11H,8-9,14H2,1-2H3;1H/t11?,13-;/m0./s1 |
| InChIKey | GIEDFGXZKMSAJZ-IYWIJXFJSA-N |
| XLogP | 1.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride?
The IUPAC name of (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride (CID 45261492) is (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride.
What is the SMILES notation for (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride?
The canonical SMILES for (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride is CN(C)C(=O)[C@]1(c2ccccc2)CC1CN.Cl.
What is the InChIKey of (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride?
The InChIKey is GIEDFGXZKMSAJZ-IYWIJXFJSA-N. The full InChI is InChI=1S/C13H18N2O.ClH/c1-15(2)12(16)13(8-11(13)9-14)10-6-4-3-5-7-10;/h3-7,11H,8-9,14H2,1-2H3;1H/t11?,13-;/m0./s1.
What are the key properties of (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride?
(1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride has a molecular weight of 254.76 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-(aminomethyl)-N,N-dimethyl-1-phenylcyclopropane-1-carboxamide;hydrochloride is sourced from PubChem (CID 45261492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).