About 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide
2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide (PubChem CID 45261526) has the molecular formula C7H13BrN2S
and a molecular weight of 237.17 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide.
Molecular Properties
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide |
| PubChem CID | 45261526 |
| Molecular Formula | C7H13BrN2S |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide |
| SMILES | Br.Cc1nc(C)c(CCN)s1 |
| InChI | InChI=1S/C7H12N2S.BrH/c1-5-7(3-4-8)10-6(2)9-5;/h3-4,8H2,1-2H3;1H |
| InChIKey | HNCRMJFKDKHUCO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide?
The IUPAC name of 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide (CID 45261526) is 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide.
What is the SMILES notation for 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide?
The canonical SMILES for 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide is Br.Cc1nc(C)c(CCN)s1.
What is the InChIKey of 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide?
The InChIKey is HNCRMJFKDKHUCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2S.BrH/c1-5-7(3-4-8)10-6(2)9-5;/h3-4,8H2,1-2H3;1H.
What are the key properties of 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide?
2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide has a molecular weight of 237.17 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanamine;hydrobromide is sourced from PubChem (CID 45261526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).