C21H21ClF4N2O3 — CID 45261572
(3R)-1-[2-[(Z)-[(2,4-difluorophenyl)-(2,5-difluorophenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride (PubChem CID 45261572) has the molecular formula C21H21ClF4N2O3 and a molecular weight of 460.86 g/mol. Its IUPAC name is (3R)-1-[2-[(Z)-[(2,4-difluorophenyl)-(2,5-difluorophenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride.
| Compound Name | (3R)-1-[2-[(Z)-[(2,4-difluorophenyl)-(2,5-difluorophenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 45261572 |
| Molecular Formula | C21H21ClF4N2O3 |
| Molecular Weight | 460.86 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (3R)-1-[2-[(Z)-[(2,4-difluorophenyl)-(2,5-difluorophenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1CCCN(CCO/N=C(/c2ccc(F)cc2F)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C21H20F4N2O3.ClH/c22-14-4-6-18(24)17(10-14)20(16-5-3-15(23)11-19(16)25)26-30-9-8-27-7-1-2-13(12-27)21(28)29;/h3-6,10-11,13H,1-2,7-9,12H2,(H,28,29);1H/b26-20-;/t13-;/m1./s1 |
| InChIKey | KEQFMAKYWQYEGE-RWPGHRBZSA-N |
| XLogP | 4.23 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.86 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|