C17H18Cl3NO2 — CID 45261596
6,9-dichloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride (PubChem CID 45261596) has the molecular formula C17H18Cl3NO2 and a molecular weight of 374.70 g/mol. Its IUPAC name is 6,9-dichloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride.
| Compound Name | 6,9-dichloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride |
|---|---|
| PubChem CID | 45261596 |
| Molecular Formula | C17H18Cl3NO2 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 6,9-dichloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrochloride |
| SMILES | CN1CCc2c(Cl)c(O)c(O)c(Cl)c2C(c2ccccc2)C1.Cl |
| InChI | InChI=1S/C17H17Cl2NO2.ClH/c1-20-8-7-11-13(15(19)17(22)16(21)14(11)18)12(9-20)10-5-3-2-4-6-10;/h2-6,12,21-22H,7-9H2,1H3;1H |
| InChIKey | XAQZKJMFINCNCI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|