About (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride
(3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride (PubChem CID 45261646) has the molecular formula C21H28ClNO2S2
and a molecular weight of 426.05 g/mol. Its IUPAC name is (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride |
| PubChem CID | 45261646 |
| Molecular Formula | C21H28ClNO2S2 |
| Molecular Weight | 426.05 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride |
| SMILES | Cc1ccsc1C(=CCCCN1CCC[C@@H](C(=O)O)C1)c1sccc1C.Cl |
| InChI | InChI=1S/C21H27NO2S2.ClH/c1-15-8-12-25-19(15)18(20-16(2)9-13-26-20)7-3-4-10-22-11-5-6-17(14-22)21(23)24;/h7-9,12-13,17H,3-6,10-11,14H2,1-2H3,(H,23,24);1H/t17-;/m1./s1 |
| InChIKey | XFJWKSZFBFJGHF-UNTBIKODSA-N |
| XLogP | 5.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.05 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride?
The IUPAC name of (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride (CID 45261646) is (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride?
The canonical SMILES for (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride is Cc1ccsc1C(=CCCCN1CCC[C@@H](C(=O)O)C1)c1sccc1C.Cl.
What is the InChIKey of (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride?
The InChIKey is XFJWKSZFBFJGHF-UNTBIKODSA-N. The full InChI is InChI=1S/C21H27NO2S2.ClH/c1-15-8-12-25-19(15)18(20-16(2)9-13-26-20)7-3-4-10-22-11-5-6-17(14-22)21(23)24;/h7-9,12-13,17H,3-6,10-11,14H2,1-2H3,(H,23,24);1H/t17-;/m1./s1.
What are the key properties of (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride?
(3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride has a molecular weight of 426.05 g/mol, XLogP of 5.86, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[5,5-bis(3-methylthiophen-2-yl)pent-4-enyl]piperidine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 45261646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).