About 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride
1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride (PubChem CID 45261757) has the molecular formula C21H24ClNO
and a molecular weight of 341.88 g/mol. Its IUPAC name is 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride.
Molecular Properties
| Compound Name | 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride |
| PubChem CID | 45261757 |
| Molecular Formula | C21H24ClNO |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2CCC12CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C21H23NO.ClH/c23-20-19-9-5-4-8-18(19)10-11-21(20)12-14-22(15-13-21)16-17-6-2-1-3-7-17;/h1-9H,10-16H2;1H |
| InChIKey | TVTOPHUMVRLCHX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride?
The IUPAC name of 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride (CID 45261757) is 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride.
What is the SMILES notation for 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride?
The canonical SMILES for 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride is Cl.O=C1c2ccccc2CCC12CCN(Cc1ccccc1)CC2.
What is the InChIKey of 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride?
The InChIKey is TVTOPHUMVRLCHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO.ClH/c23-20-19-9-5-4-8-18(19)10-11-21(20)12-14-22(15-13-21)16-17-6-2-1-3-7-17;/h1-9H,10-16H2;1H.
What are the key properties of 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride?
1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride has a molecular weight of 341.88 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-benzylspiro[3,4-dihydronaphthalene-2,4'-piperidine]-1-one;hydrochloride is sourced from PubChem (CID 45261757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).