About 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride
2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride (PubChem CID 45261766) has the molecular formula C9H19ClN2
and a molecular weight of 190.72 g/mol. Its IUPAC name is 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride |
| PubChem CID | 45261766 |
| Molecular Formula | C9H19ClN2 |
| Molecular Weight | 190.72 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride |
| SMILES | CCCCC1N=C(N)CC1C.Cl |
| InChI | InChI=1S/C9H18N2.ClH/c1-3-4-5-8-7(2)6-9(10)11-8;/h7-8H,3-6H2,1-2H3,(H2,10,11);1H |
| InChIKey | LZUMPBAFPSELNB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.72 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The IUPAC name of 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride (CID 45261766) is 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride.
What is the SMILES notation for 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The canonical SMILES for 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride is CCCCC1N=C(N)CC1C.Cl.
What is the InChIKey of 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The InChIKey is LZUMPBAFPSELNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.ClH/c1-3-4-5-8-7(2)6-9(10)11-8;/h7-8H,3-6H2,1-2H3,(H2,10,11);1H.
What are the key properties of 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride has a molecular weight of 190.72 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-methyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride is sourced from PubChem (CID 45261766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).