C14H19ClN2O4S3 — CID 45261768
4-[3-[(propan-2-ylamino)methyl]phenyl]sulfonylthiophene-2-sulfonamide;hydrochloride (PubChem CID 45261768) has the molecular formula C14H19ClN2O4S3 and a molecular weight of 410.97 g/mol. Its IUPAC name is 4-[3-[(propan-2-ylamino)methyl]phenyl]sulfonylthiophene-2-sulfonamide;hydrochloride.
| Compound Name | 4-[3-[(propan-2-ylamino)methyl]phenyl]sulfonylthiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 45261768 |
| Molecular Formula | C14H19ClN2O4S3 |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 4-[3-[(propan-2-ylamino)methyl]phenyl]sulfonylthiophene-2-sulfonamide;hydrochloride |
| SMILES | CC(C)NCc1cccc(S(=O)(=O)c2csc(S(N)(=O)=O)c2)c1.Cl |
| InChI | InChI=1S/C14H18N2O4S3.ClH/c1-10(2)16-8-11-4-3-5-12(6-11)22(17,18)13-7-14(21-9-13)23(15,19)20;/h3-7,9-10,16H,8H2,1-2H3,(H2,15,19,20);1H |
| InChIKey | IGKDLCRPGUQJPW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |