About 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride
2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride (PubChem CID 45261773) has the molecular formula C11H20Cl2N4S
and a molecular weight of 311.28 g/mol. Its IUPAC name is 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride.
Molecular Properties
| Compound Name | 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride |
| PubChem CID | 45261773 |
| Molecular Formula | C11H20Cl2N4S |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\SCCNCCCN)c1cccnc1 |
| InChI | InChI=1S/C11H18N4S.2ClH/c12-4-2-6-14-7-8-16-11(13)10-3-1-5-15-9-10;;/h1,3,5,9,13-14H,2,4,6-8,12H2;2*1H/b13-11-;; |
| InChIKey | UFRZHVGLHFWDHO-UYILYQNDSA-N |
| XLogP | 1.92 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride?
The IUPAC name of 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride (CID 45261773) is 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride.
What is the SMILES notation for 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride?
The canonical SMILES for 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride is Cl.Cl.[H]/N=C(\SCCNCCCN)c1cccnc1.
What is the InChIKey of 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride?
The InChIKey is UFRZHVGLHFWDHO-UYILYQNDSA-N. The full InChI is InChI=1S/C11H18N4S.2ClH/c12-4-2-6-14-7-8-16-11(13)10-3-1-5-15-9-10;;/h1,3,5,9,13-14H,2,4,6-8,12H2;2*1H/b13-11-;;.
What are the key properties of 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride?
2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride has a molecular weight of 311.28 g/mol, XLogP of 1.92, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopropylamino)ethyl pyridine-3-carboximidothioate;dihydrochloride is sourced from PubChem (CID 45261773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).