About N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride
N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride (PubChem CID 45261796) has the molecular formula C11H19Cl3N2S
and a molecular weight of 317.71 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride |
| PubChem CID | 45261796 |
| Molecular Formula | C11H19Cl3N2S |
| Molecular Weight | 317.71 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCCCNCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H17ClN2S.2ClH/c12-10-2-4-11(5-3-10)15-9-8-14-7-1-6-13;;/h2-5,14H,1,6-9,13H2;2*1H |
| InChIKey | FZPOMKHQMNHMAR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride?
The IUPAC name of N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride (CID 45261796) is N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride.
What is the SMILES notation for N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride?
The canonical SMILES for N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride is Cl.Cl.NCCCNCCSc1ccc(Cl)cc1.
What is the InChIKey of N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride?
The InChIKey is FZPOMKHQMNHMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2S.2ClH/c12-10-2-4-11(5-3-10)15-9-8-14-7-1-6-13;;/h2-5,14H,1,6-9,13H2;2*1H.
What are the key properties of N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride?
N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride has a molecular weight of 317.71 g/mol, XLogP of 3.21, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(4-chlorophenyl)sulfanylethyl]propane-1,3-diamine;dihydrochloride is sourced from PubChem (CID 45261796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).