About 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride
3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride (PubChem CID 45261804) has the molecular formula C11H13ClN4
and a molecular weight of 236.71 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride |
| PubChem CID | 45261804 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride |
| SMILES | C/N=C(\N)c1cccc(-c2cnc[nH]2)c1.Cl |
| InChI | InChI=1S/C11H12N4.ClH/c1-13-11(12)9-4-2-3-8(5-9)10-6-14-7-15-10;/h2-7H,1H3,(H2,12,13)(H,14,15);1H |
| InChIKey | QZIIREUMOPPBFE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride?
The IUPAC name of 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride (CID 45261804) is 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride.
What is the SMILES notation for 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride?
The canonical SMILES for 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride is C/N=C(\N)c1cccc(-c2cnc[nH]2)c1.Cl.
What is the InChIKey of 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride?
The InChIKey is QZIIREUMOPPBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4.ClH/c1-13-11(12)9-4-2-3-8(5-9)10-6-14-7-15-10;/h2-7H,1H3,(H2,12,13)(H,14,15);1H.
What are the key properties of 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride?
3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride has a molecular weight of 236.71 g/mol, XLogP of 1.83, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-5-yl)-N'-methylbenzenecarboximidamide;hydrochloride is sourced from PubChem (CID 45261804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).