C8H22Cl2N2S — CID 45261813
N'-(2-propan-2-ylsulfanylethyl)propane-1,3-diamine;dihydrochloride (PubChem CID 45261813) has the molecular formula C8H22Cl2N2S and a molecular weight of 249.25 g/mol. Its IUPAC name is N'-(2-propan-2-ylsulfanylethyl)propane-1,3-diamine;dihydrochloride.
| Compound Name | N'-(2-propan-2-ylsulfanylethyl)propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 45261813 |
| Molecular Formula | C8H22Cl2N2S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N'-(2-propan-2-ylsulfanylethyl)propane-1,3-diamine;dihydrochloride |
| SMILES | CC(C)SCCNCCCN.Cl.Cl |
| InChI | InChI=1S/C8H20N2S.2ClH/c1-8(2)11-7-6-10-5-3-4-9;;/h8,10H,3-7,9H2,1-2H3;2*1H |
| InChIKey | BWXPXIOISSSLOT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|