C15H21ClN2O4S3 — CID 45261845
4-[3-[(butan-2-ylamino)methyl]phenyl]sulfonylthiophene-2-sulfonamide;hydrochloride (PubChem CID 45261845) has the molecular formula C15H21ClN2O4S3 and a molecular weight of 425.00 g/mol. Its IUPAC name is 4-[3-[(butan-2-ylamino)methyl]phenyl]sulfonylthiophene-2-sulfonamide;hydrochloride.
| Compound Name | 4-[3-[(butan-2-ylamino)methyl]phenyl]sulfonylthiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 45261845 |
| Molecular Formula | C15H21ClN2O4S3 |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 4-[3-[(butan-2-ylamino)methyl]phenyl]sulfonylthiophene-2-sulfonamide;hydrochloride |
| SMILES | CCC(C)NCc1cccc(S(=O)(=O)c2csc(S(N)(=O)=O)c2)c1.Cl |
| InChI | InChI=1S/C15H20N2O4S3.ClH/c1-3-11(2)17-9-12-5-4-6-13(7-12)23(18,19)14-8-15(22-10-14)24(16,20)21;/h4-8,10-11,17H,3,9H2,1-2H3,(H2,16,20,21);1H |
| InChIKey | GYCKSTGOBSGQSV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |