C15H25ClN12 — CID 45261938
2-[(E)-1-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]guanidine;hydrochloride (PubChem CID 45261938) has the molecular formula C15H25ClN12 and a molecular weight of 408.90 g/mol. Its IUPAC name is 2-[(E)-1-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-1-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 45261938 |
| Molecular Formula | C15H25ClN12 |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[(E)-1-[3,5-bis[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]guanidine;hydrochloride |
| SMILES | C/C(=N\N=C(N)N)c1cc(/C(C)=N/N=C(N)N)cc(/C(C)=N/N=C(N)N)c1.Cl |
| InChI | InChI=1S/C15H24N12.ClH/c1-7(22-25-13(16)17)10-4-11(8(2)23-26-14(18)19)6-12(5-10)9(3)24-27-15(20)21;/h4-6H,1-3H3,(H4,16,17,25)(H4,18,19,26)(H4,20,21,27);1H/b22-7+,23-8+,24-9+; |
| InChIKey | GQKMIBCNDULIQY-NFBURRIDSA-N |
| XLogP | -0.90 |
| TPSA | 230.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|