C18H23Cl2N3S — CID 45262006
2-(2-chloro-3-ethyl-5-methylsulfanylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride (PubChem CID 45262006) has the molecular formula C18H23Cl2N3S and a molecular weight of 384.38 g/mol. Its IUPAC name is 2-(2-chloro-3-ethyl-5-methylsulfanylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride.
| Compound Name | 2-(2-chloro-3-ethyl-5-methylsulfanylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 45262006 |
| Molecular Formula | C18H23Cl2N3S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-(2-chloro-3-ethyl-5-methylsulfanylphenyl)-1-(3-ethylphenyl)guanidine;hydrochloride |
| SMILES | CCc1cccc(N/C(N)=N/c2cc(SC)cc(CC)c2Cl)c1.Cl |
| InChI | InChI=1S/C18H22ClN3S.ClH/c1-4-12-7-6-8-14(9-12)21-18(20)22-16-11-15(23-3)10-13(5-2)17(16)19;/h6-11H,4-5H2,1-3H3,(H3,20,21,22);1H |
| InChIKey | HELYBVKMVREKPG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|