About 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride
2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride (PubChem CID 45262069) has the molecular formula C15H16Cl3N3
and a molecular weight of 344.67 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride |
| PubChem CID | 45262069 |
| Molecular Formula | C15H16Cl3N3 |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride |
| SMILES | CCc1cccc(N/C(N)=N/c2c(Cl)cccc2Cl)c1.Cl |
| InChI | InChI=1S/C15H15Cl2N3.ClH/c1-2-10-5-3-6-11(9-10)19-15(18)20-14-12(16)7-4-8-13(14)17;/h3-9H,2H2,1H3,(H3,18,19,20);1H |
| InChIKey | HCULZJHUMXBCIY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride?
The IUPAC name of 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride (CID 45262069) is 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride.
What is the SMILES notation for 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride?
The canonical SMILES for 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride is CCc1cccc(N/C(N)=N/c2c(Cl)cccc2Cl)c1.Cl.
What is the InChIKey of 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride?
The InChIKey is HCULZJHUMXBCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2N3.ClH/c1-2-10-5-3-6-11(9-10)19-15(18)20-14-12(16)7-4-8-13(14)17;/h3-9H,2H2,1H3,(H3,18,19,20);1H.
What are the key properties of 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride?
2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride has a molecular weight of 344.67 g/mol, XLogP of 5.04, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenyl)-1-(3-ethylphenyl)guanidine;hydrochloride is sourced from PubChem (CID 45262069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).