About 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride
3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride (PubChem CID 45262088) has the molecular formula C13H20ClNO2
and a molecular weight of 257.76 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride |
| PubChem CID | 45262088 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride |
| SMILES | Cl.OCCCNCC1CCc2ccccc2O1 |
| InChI | InChI=1S/C13H19NO2.ClH/c15-9-3-8-14-10-12-7-6-11-4-1-2-5-13(11)16-12;/h1-2,4-5,12,14-15H,3,6-10H2;1H |
| InChIKey | JUKQXQAIODMUQU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride?
The IUPAC name of 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride (CID 45262088) is 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride.
What is the SMILES notation for 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride?
The canonical SMILES for 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride is Cl.OCCCNCC1CCc2ccccc2O1.
What is the InChIKey of 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride?
The InChIKey is JUKQXQAIODMUQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.ClH/c15-9-3-8-14-10-12-7-6-11-4-1-2-5-13(11)16-12;/h1-2,4-5,12,14-15H,3,6-10H2;1H.
What are the key properties of 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride?
3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride has a molecular weight of 257.76 g/mol, XLogP of 1.77, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-chromen-2-ylmethylamino)propan-1-ol;hydrochloride is sourced from PubChem (CID 45262088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).