About 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride
2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride (PubChem CID 45262101) has the molecular formula C17H20Br2ClN3OS
and a molecular weight of 509.70 g/mol. Its IUPAC name is 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
| PubChem CID | 45262101 |
| Molecular Formula | C17H20Br2ClN3OS |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 506.94 |
| IUPAC Name | 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
| SMILES | CCc1cccc(N(C)/C(N)=N/c2cc(Br)cc(S(C)=O)c2Br)c1.Cl |
| InChI | InChI=1S/C17H19Br2N3OS.ClH/c1-4-11-6-5-7-13(8-11)22(2)17(20)21-14-9-12(18)10-15(16(14)19)24(3)23;/h5-10H,4H2,1-3H3,(H2,20,21);1H |
| InChIKey | WDYOYZUYUJQBEY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride?
The IUPAC name of 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride (CID 45262101) is 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride.
What is the SMILES notation for 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride?
The canonical SMILES for 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride is CCc1cccc(N(C)/C(N)=N/c2cc(Br)cc(S(C)=O)c2Br)c1.Cl.
What is the InChIKey of 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride?
The InChIKey is WDYOYZUYUJQBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Br2N3OS.ClH/c1-4-11-6-5-7-13(8-11)22(2)17(20)21-14-9-12(18)10-15(16(14)19)24(3)23;/h5-10H,4H2,1-3H3,(H2,20,21);1H.
What are the key properties of 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride?
2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride has a molecular weight of 509.70 g/mol, XLogP of 5.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dibromo-3-methylsulfinylphenyl)-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride is sourced from PubChem (CID 45262101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).