C6H10ClNO2 — CID 45262160
(1R,2S)-2-aminocyclopent-3-ene-1-carboxylic acid;hydrochloride (PubChem CID 45262160) has the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. Its IUPAC name is (1R,2S)-2-aminocyclopent-3-ene-1-carboxylic acid;hydrochloride.
| Compound Name | (1R,2S)-2-aminocyclopent-3-ene-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 45262160 |
| Molecular Formula | C6H10ClNO2 |
| Molecular Weight | 163.60 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | (1R,2S)-2-aminocyclopent-3-ene-1-carboxylic acid;hydrochloride |
| SMILES | Cl.N[C@H]1C=CC[C@H]1C(=O)O |
| InChI | InChI=1S/C6H9NO2.ClH/c7-5-3-1-2-4(5)6(8)9;/h1,3-5H,2,7H2,(H,8,9);1H/t4-,5+;/m1./s1 |
| InChIKey | NJIAFLWOIUSOSY-JBUOLDKXSA-N |
| XLogP | 0.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.60 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|