About 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride
4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride (PubChem CID 45262191) has the molecular formula C18H31ClN2O2
and a molecular weight of 342.91 g/mol. Its IUPAC name is 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride |
| PubChem CID | 45262191 |
| Molecular Formula | C18H31ClN2O2 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride |
| SMILES | CCNc1ccc(OCC2CCN(CC3CC3)CC2)cc1.Cl.O |
| InChI | InChI=1S/C18H28N2O.ClH.H2O/c1-2-19-17-5-7-18(8-6-17)21-14-16-9-11-20(12-10-16)13-15-3-4-15;;/h5-8,15-16,19H,2-4,9-14H2,1H3;1H;1H2 |
| InChIKey | OWBWCVASCAZOMQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride?
The IUPAC name of 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride (CID 45262191) is 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride.
What is the SMILES notation for 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride?
The canonical SMILES for 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride is CCNc1ccc(OCC2CCN(CC3CC3)CC2)cc1.Cl.O.
What is the InChIKey of 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride?
The InChIKey is OWBWCVASCAZOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O.ClH.H2O/c1-2-19-17-5-7-18(8-6-17)21-14-16-9-11-20(12-10-16)13-15-3-4-15;;/h5-8,15-16,19H,2-4,9-14H2,1H3;1H;1H2.
What are the key properties of 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride?
4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride has a molecular weight of 342.91 g/mol, XLogP of 3.22, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(cyclopropylmethyl)piperidin-4-yl]methoxy]-N-ethylaniline;hydrate;hydrochloride is sourced from PubChem (CID 45262191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).