About 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride
4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride (PubChem CID 45262200) has the molecular formula C20H25ClN2O6S
and a molecular weight of 456.95 g/mol. Its IUPAC name is 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride |
| PubChem CID | 45262200 |
| Molecular Formula | C20H25ClN2O6S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCCC(CNS(=O)(=O)c1ccc(C(=O)O)cc1)c1cccnc1 |
| InChI | InChI=1S/C20H24N2O6S.ClH/c23-19(24)7-3-1-2-5-17(16-6-4-12-21-13-16)14-22-29(27,28)18-10-8-15(9-11-18)20(25)26;/h4,6,8-13,17,22H,1-3,5,7,14H2,(H,23,24)(H,25,26);1H |
| InChIKey | XRDWYWQTOHNEPE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride?
The IUPAC name of 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride (CID 45262200) is 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride.
What is the SMILES notation for 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride?
The canonical SMILES for 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride is Cl.O=C(O)CCCCCC(CNS(=O)(=O)c1ccc(C(=O)O)cc1)c1cccnc1.
What is the InChIKey of 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride?
The InChIKey is XRDWYWQTOHNEPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O6S.ClH/c23-19(24)7-3-1-2-5-17(16-6-4-12-21-13-16)14-22-29(27,28)18-10-8-15(9-11-18)20(25)26;/h4,6,8-13,17,22H,1-3,5,7,14H2,(H,23,24)(H,25,26);1H.
What are the key properties of 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride?
4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride has a molecular weight of 456.95 g/mol, XLogP of 3.30, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-carboxy-2-pyridin-3-ylheptyl)sulfamoyl]benzoic acid;hydrochloride is sourced from PubChem (CID 45262200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).