About (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride
(5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride (PubChem CID 45262264) has the molecular formula C22H23ClN2O2
and a molecular weight of 382.89 g/mol. Its IUPAC name is (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride.
Molecular Properties
| Compound Name | (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride |
| PubChem CID | 45262264 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride |
| SMILES | CCc1nccn1C[C@@H]1CC(c2ccccc2)(c2ccccc2)C(=O)O1.Cl |
| InChI | InChI=1S/C22H22N2O2.ClH/c1-2-20-23-13-14-24(20)16-19-15-22(21(25)26-19,17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-14,19H,2,15-16H2,1H3;1H/t19-;/m0./s1 |
| InChIKey | ZXRMDNARIPAEBO-FYZYNONXSA-N |
| XLogP | 4.17 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
The IUPAC name of (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride (CID 45262264) is (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride.
What is the SMILES notation for (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
The canonical SMILES for (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride is CCc1nccn1C[C@@H]1CC(c2ccccc2)(c2ccccc2)C(=O)O1.Cl.
What is the InChIKey of (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
The InChIKey is ZXRMDNARIPAEBO-FYZYNONXSA-N. The full InChI is InChI=1S/C22H22N2O2.ClH/c1-2-20-23-13-14-24(20)16-19-15-22(21(25)26-19,17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-14,19H,2,15-16H2,1H3;1H/t19-;/m0./s1.
What are the key properties of (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride?
(5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride has a molecular weight of 382.89 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[(2-ethylimidazol-1-yl)methyl]-3,3-diphenyloxolan-2-one;hydrochloride is sourced from PubChem (CID 45262264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).