C17H22ClNO — CID 45262334
(1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride (PubChem CID 45262334) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride.
| Compound Name | (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 45262334 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride |
| SMILES | CN(C)C[C@@H](c1ccccc1)[C@@H](O)c1ccccc1.Cl |
| InChI | InChI=1S/C17H21NO.ClH/c1-18(2)13-16(14-9-5-3-6-10-14)17(19)15-11-7-4-8-12-15;/h3-12,16-17,19H,13H2,1-2H3;1H/t16-,17-;/m0./s1 |
| InChIKey | WSDLKTZBSNTKJA-QJHJCNPRSA-N |
| XLogP | 3.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |