About (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride
(1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride (PubChem CID 45262334) has the molecular formula C17H22ClNO
and a molecular weight of 291.82 g/mol. Its IUPAC name is (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride |
| PubChem CID | 45262334 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride |
| SMILES | CN(C)C[C@@H](c1ccccc1)[C@@H](O)c1ccccc1.Cl |
| InChI | InChI=1S/C17H21NO.ClH/c1-18(2)13-16(14-9-5-3-6-10-14)17(19)15-11-7-4-8-12-15;/h3-12,16-17,19H,13H2,1-2H3;1H/t16-,17-;/m0./s1 |
| InChIKey | WSDLKTZBSNTKJA-QJHJCNPRSA-N |
| XLogP | 3.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride?
The IUPAC name of (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride (CID 45262334) is (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride.
What is the SMILES notation for (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride?
The canonical SMILES for (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride is CN(C)C[C@@H](c1ccccc1)[C@@H](O)c1ccccc1.Cl.
What is the InChIKey of (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride?
The InChIKey is WSDLKTZBSNTKJA-QJHJCNPRSA-N. The full InChI is InChI=1S/C17H21NO.ClH/c1-18(2)13-16(14-9-5-3-6-10-14)17(19)15-11-7-4-8-12-15;/h3-12,16-17,19H,13H2,1-2H3;1H/t16-,17-;/m0./s1.
What are the key properties of (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride?
(1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride has a molecular weight of 291.82 g/mol, XLogP of 3.49, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-3-(dimethylamino)-1,2-diphenylpropan-1-ol;hydrochloride is sourced from PubChem (CID 45262334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).