About (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride
(2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride (PubChem CID 45262357) has the molecular formula C19H28ClNO
and a molecular weight of 321.89 g/mol. Its IUPAC name is (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride.
Molecular Properties
| Compound Name | (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride |
| PubChem CID | 45262357 |
| Molecular Formula | C19H28ClNO |
| Molecular Weight | 321.89 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride |
| SMILES | CN(C)C[C@@H](c1ccc2ccccc2c1)[C@@H](O)C(C)(C)C.Cl |
| InChI | InChI=1S/C19H27NO.ClH/c1-19(2,3)18(21)17(13-20(4)5)16-11-10-14-8-6-7-9-15(14)12-16;/h6-12,17-18,21H,13H2,1-5H3;1H/t17-,18+;/m0./s1 |
| InChIKey | SFESMQNHNIKYIQ-CJRXIRLBSA-N |
| XLogP | 4.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride?
The IUPAC name of (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride (CID 45262357) is (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride.
What is the SMILES notation for (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride?
The canonical SMILES for (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride is CN(C)C[C@@H](c1ccc2ccccc2c1)[C@@H](O)C(C)(C)C.Cl.
What is the InChIKey of (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride?
The InChIKey is SFESMQNHNIKYIQ-CJRXIRLBSA-N. The full InChI is InChI=1S/C19H27NO.ClH/c1-19(2,3)18(21)17(13-20(4)5)16-11-10-14-8-6-7-9-15(14)12-16;/h6-12,17-18,21H,13H2,1-5H3;1H/t17-,18+;/m0./s1.
What are the key properties of (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride?
(2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride has a molecular weight of 321.89 g/mol, XLogP of 4.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-1-(dimethylamino)-4,4-dimethyl-2-naphthalen-2-ylpentan-3-ol;hydrochloride is sourced from PubChem (CID 45262357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).