C14H20ClN3O — CID 45262670
7-methoxy-1,3,3a,4,5,6-hexahydrobenzo[de]isoquinoline-2-carboximidamide;hydrochloride (PubChem CID 45262670) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 7-methoxy-1,3,3a,4,5,6-hexahydrobenzo[de]isoquinoline-2-carboximidamide;hydrochloride.
| Compound Name | 7-methoxy-1,3,3a,4,5,6-hexahydrobenzo[de]isoquinoline-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 45262670 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 7-methoxy-1,3,3a,4,5,6-hexahydrobenzo[de]isoquinoline-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1Cc2ccc(OC)c3c2C(CCC3)C1 |
| InChI | InChI=1S/C14H19N3O.ClH/c1-18-12-6-5-10-8-17(14(15)16)7-9-3-2-4-11(12)13(9)10;/h5-6,9H,2-4,7-8H2,1H3,(H3,15,16);1H |
| InChIKey | CHWALKWMSVNUIS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|