C26H35ClN2O2 — CID 45262675
2-(3,4-dimethylphenyl)-N-[(1S,2S)-5-methoxy-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylacetamide;hydrochloride (PubChem CID 45262675) has the molecular formula C26H35ClN2O2 and a molecular weight of 443.03 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-[(1S,2S)-5-methoxy-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylacetamide;hydrochloride.
| Compound Name | 2-(3,4-dimethylphenyl)-N-[(1S,2S)-5-methoxy-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 45262675 |
| Molecular Formula | C26H35ClN2O2 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-[(1S,2S)-5-methoxy-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylacetamide;hydrochloride |
| SMILES | COc1cccc2c1CC[C@H](N1CCCC1)[C@H]2N(C)C(=O)Cc1ccc(C)c(C)c1.Cl |
| InChI | InChI=1S/C26H34N2O2.ClH/c1-18-10-11-20(16-19(18)2)17-25(29)27(3)26-22-8-7-9-24(30-4)21(22)12-13-23(26)28-14-5-6-15-28;/h7-11,16,23,26H,5-6,12-15,17H2,1-4H3;1H/t23-,26-;/m0./s1 |
| InChIKey | IMAGPFTVXCTGIW-MHUAFMOUSA-N |
| XLogP | 4.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |