C23H32ClNO2 — CID 45262716
1-[(10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraen-12-yl]pentan-1-one;hydrochloride (PubChem CID 45262716) has the molecular formula C23H32ClNO2 and a molecular weight of 389.97 g/mol. Its IUPAC name is 1-[(10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraen-12-yl]pentan-1-one;hydrochloride.
| Compound Name | 1-[(10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraen-12-yl]pentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 45262716 |
| Molecular Formula | C23H32ClNO2 |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-[(10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraen-12-yl]pentan-1-one;hydrochloride |
| SMILES | CCCCC(=O)C1=CCC23CCN(C)C(Cc4ccc(OC)cc42)[C@H]3C1.Cl |
| InChI | InChI=1S/C23H31NO2.ClH/c1-4-5-6-22(25)17-9-10-23-11-12-24(2)21(20(23)13-17)14-16-7-8-18(26-3)15-19(16)23;/h7-9,15,20-21H,4-6,10-14H2,1-3H3;1H/t20-,21?,23?;/m1./s1 |
| InChIKey | JTIKAAXEWYSRJT-LTLBKSJRSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |