About N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride
N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride (PubChem CID 45262788) has the molecular formula C13H20ClN
and a molecular weight of 225.76 g/mol. Its IUPAC name is N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| PubChem CID | 45262788 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| SMILES | CCCCNC1Cc2ccccc2C1.Cl |
| InChI | InChI=1S/C13H19N.ClH/c1-2-3-8-14-13-9-11-6-4-5-7-12(11)10-13;/h4-7,13-14H,2-3,8-10H2,1H3;1H |
| InChIKey | DLKXWQMOZQYHMT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride?
The IUPAC name of N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride (CID 45262788) is N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride.
What is the SMILES notation for N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride?
The canonical SMILES for N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride is CCCCNC1Cc2ccccc2C1.Cl.
What is the InChIKey of N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride?
The InChIKey is DLKXWQMOZQYHMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N.ClH/c1-2-3-8-14-13-9-11-6-4-5-7-12(11)10-13;/h4-7,13-14H,2-3,8-10H2,1H3;1H.
What are the key properties of N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride?
N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride has a molecular weight of 225.76 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2,3-dihydro-1H-inden-2-amine;hydrochloride is sourced from PubChem (CID 45262788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).