C16H10F14N2O2 — CID 4526280
2,2,3,3,4,4,4-heptafluoro-N-[[4-[(2,2,3,3,4,4,4-heptafluorobutanoylamino)methyl]phenyl]methyl]butanamide (PubChem CID 4526280) has the molecular formula C16H10F14N2O2 and a molecular weight of 528.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[[4-[(2,2,3,3,4,4,4-heptafluorobutanoylamino)methyl]phenyl]methyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[[4-[(2,2,3,3,4,4,4-heptafluorobutanoylamino)methyl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 4526280 |
| Molecular Formula | C16H10F14N2O2 |
| Molecular Weight | 528.24 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[[4-[(2,2,3,3,4,4,4-heptafluorobutanoylamino)methyl]phenyl]methyl]butanamide |
| SMILES | O=C(NCc1ccc(CNC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H10F14N2O2/c17-11(18,13(21,22)15(25,26)27)9(33)31-5-7-1-2-8(4-3-7)6-32-10(34)12(19,20)14(23,24)16(28,29)30/h1-4H,5-6H2,(H,31,33)(H,32,34) |
| InChIKey | JPWSUODUKNKFBM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.24 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|