About N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride
N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride (PubChem CID 45262812) has the molecular formula C24H29ClN4
and a molecular weight of 408.98 g/mol. Its IUPAC name is N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride |
| PubChem CID | 45262812 |
| Molecular Formula | C24H29ClN4 |
| Molecular Weight | 408.98 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride |
| SMILES | Cl.c1ccc(-c2ccc(NCCCCCN3CCc4ccccc4C3)nn2)cc1 |
| InChI | InChI=1S/C24H28N4.ClH/c1-3-10-21(11-4-1)23-13-14-24(27-26-23)25-16-7-2-8-17-28-18-15-20-9-5-6-12-22(20)19-28;/h1,3-6,9-14H,2,7-8,15-19H2,(H,25,27);1H |
| InChIKey | FSUDETCTBFTIHA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.98 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride?
The IUPAC name of N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride (CID 45262812) is N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride.
What is the SMILES notation for N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride?
The canonical SMILES for N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride is Cl.c1ccc(-c2ccc(NCCCCCN3CCc4ccccc4C3)nn2)cc1.
What is the InChIKey of N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride?
The InChIKey is FSUDETCTBFTIHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4.ClH/c1-3-10-21(11-4-1)23-13-14-24(27-26-23)25-16-7-2-8-17-28-18-15-20-9-5-6-12-22(20)19-28;/h1,3-6,9-14H,2,7-8,15-19H2,(H,25,27);1H.
What are the key properties of N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride?
N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride has a molecular weight of 408.98 g/mol, XLogP of 5.21, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-6-phenylpyridazin-3-amine;hydrochloride is sourced from PubChem (CID 45262812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).