C22H28ClN — CID 45262906
(4aS,9R,9aR)-2-ethyl-7-methyl-9-(4-methylphenyl)-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridine;hydrochloride (PubChem CID 45262906) has the molecular formula C22H28ClN and a molecular weight of 341.93 g/mol. Its IUPAC name is (4aS,9R,9aR)-2-ethyl-7-methyl-9-(4-methylphenyl)-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridine;hydrochloride.
| Compound Name | (4aS,9R,9aR)-2-ethyl-7-methyl-9-(4-methylphenyl)-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 45262906 |
| Molecular Formula | C22H28ClN |
| Molecular Weight | 341.93 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (4aS,9R,9aR)-2-ethyl-7-methyl-9-(4-methylphenyl)-1,3,4,4a,9,9a-hexahydroindeno[2,1-c]pyridine;hydrochloride |
| SMILES | CCN1CC[C@@H]2c3ccc(C)cc3[C@@H](c3ccc(C)cc3)[C@@H]2C1.Cl |
| InChI | InChI=1S/C22H27N.ClH/c1-4-23-12-11-19-18-10-7-16(3)13-20(18)22(21(19)14-23)17-8-5-15(2)6-9-17;/h5-10,13,19,21-22H,4,11-12,14H2,1-3H3;1H/t19-,21-,22-;/m1./s1 |
| InChIKey | KSWZYZWACMWTEV-NCBCLDNOSA-N |
| XLogP | 5.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |