About (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride
(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride (PubChem CID 45263001) has the molecular formula C12H11ClN4S
and a molecular weight of 278.77 g/mol. Its IUPAC name is (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride |
| PubChem CID | 45263001 |
| Molecular Formula | C12H11ClN4S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride |
| SMILES | Cl.NNc1nnc(-c2cccc3ccccc23)s1 |
| InChI | InChI=1S/C12H10N4S.ClH/c13-14-12-16-15-11(17-12)10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,13H2,(H,14,16);1H |
| InChIKey | FTZRXZBCZGFATQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride?
The IUPAC name of (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride (CID 45263001) is (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride.
What is the SMILES notation for (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride?
The canonical SMILES for (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride is Cl.NNc1nnc(-c2cccc3ccccc23)s1.
What is the InChIKey of (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride?
The InChIKey is FTZRXZBCZGFATQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4S.ClH/c13-14-12-16-15-11(17-12)10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,13H2,(H,14,16);1H.
What are the key properties of (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride?
(5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride has a molecular weight of 278.77 g/mol, XLogP of 3.07, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-naphthalen-1-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride is sourced from PubChem (CID 45263001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).