About 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride
2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride (PubChem CID 45263003) has the molecular formula C10H9ClF3N5S
and a molecular weight of 323.73 g/mol. Its IUPAC name is 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
| PubChem CID | 45263003 |
| Molecular Formula | C10H9ClF3N5S |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nnc(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C10H8F3N5S.ClH/c11-10(12,13)6-3-1-2-5(4-6)7-17-18-9(19-7)16-8(14)15;/h1-4H,(H4,14,15,16,18);1H |
| InChIKey | WBXKBMOKGGGLDW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride?
The IUPAC name of 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride (CID 45263003) is 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride.
What is the SMILES notation for 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride?
The canonical SMILES for 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride is Cl.NC(N)=Nc1nnc(-c2cccc(C(F)(F)F)c2)s1.
What is the InChIKey of 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride?
The InChIKey is WBXKBMOKGGGLDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N5S.ClH/c11-10(12,13)6-3-1-2-5(4-6)7-17-18-9(19-7)16-8(14)15;/h1-4H,(H4,14,15,16,18);1H.
What are the key properties of 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride?
2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride has a molecular weight of 323.73 g/mol, XLogP of 2.55, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride is sourced from PubChem (CID 45263003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).