About (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride
(5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride (PubChem CID 45263024) has the molecular formula C6H7ClN4S2
and a molecular weight of 234.74 g/mol. Its IUPAC name is (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride |
| PubChem CID | 45263024 |
| Molecular Formula | C6H7ClN4S2 |
| Molecular Weight | 234.74 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride |
| SMILES | Cl.NNc1nnc(-c2ccsc2)s1 |
| InChI | InChI=1S/C6H6N4S2.ClH/c7-8-6-10-9-5(12-6)4-1-2-11-3-4;/h1-3H,7H2,(H,8,10);1H |
| InChIKey | PCNLUPQLHAFRCK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.74 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride?
The IUPAC name of (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride (CID 45263024) is (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride.
What is the SMILES notation for (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride?
The canonical SMILES for (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride is Cl.NNc1nnc(-c2ccsc2)s1.
What is the InChIKey of (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride?
The InChIKey is PCNLUPQLHAFRCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S2.ClH/c7-8-6-10-9-5(12-6)4-1-2-11-3-4;/h1-3H,7H2,(H,8,10);1H.
What are the key properties of (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride?
(5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride has a molecular weight of 234.74 g/mol, XLogP of 1.97, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-thiophen-3-yl-1,3,4-thiadiazol-2-yl)hydrazine;hydrochloride is sourced from PubChem (CID 45263024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).