About [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride
[5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride (PubChem CID 45263029) has the molecular formula C8H8ClN5O2S
and a molecular weight of 273.71 g/mol. Its IUPAC name is [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride.
Molecular Properties
| Compound Name | [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride |
| PubChem CID | 45263029 |
| Molecular Formula | C8H8ClN5O2S |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride |
| SMILES | Cl.NNc1nnc(-c2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H7N5O2S.ClH/c9-10-8-12-11-7(16-8)5-3-1-2-4-6(5)13(14)15;/h1-4H,9H2,(H,10,12);1H |
| InChIKey | QEONEPKCBVNMCI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride?
The IUPAC name of [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride (CID 45263029) is [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride.
What is the SMILES notation for [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride?
The canonical SMILES for [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride is Cl.NNc1nnc(-c2ccccc2[N+](=O)[O-])s1.
What is the InChIKey of [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride?
The InChIKey is QEONEPKCBVNMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O2S.ClH/c9-10-8-12-11-7(16-8)5-3-1-2-4-6(5)13(14)15;/h1-4H,9H2,(H,10,12);1H.
What are the key properties of [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride?
[5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride has a molecular weight of 273.71 g/mol, XLogP of 1.82, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-nitrophenyl)-1,3,4-thiadiazol-2-yl]hydrazine;hydrochloride is sourced from PubChem (CID 45263029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).