About 4-(diethylamino)butyl thiocyanate;hydrochloride
4-(diethylamino)butyl thiocyanate;hydrochloride (PubChem CID 45263076) has the molecular formula C9H19ClN2S
and a molecular weight of 222.78 g/mol. Its IUPAC name is 4-(diethylamino)butyl thiocyanate;hydrochloride.
Molecular Properties
| Compound Name | 4-(diethylamino)butyl thiocyanate;hydrochloride |
| PubChem CID | 45263076 |
| Molecular Formula | C9H19ClN2S |
| Molecular Weight | 222.78 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-(diethylamino)butyl thiocyanate;hydrochloride |
| SMILES | CCN(CC)CCCCSC#N.Cl |
| InChI | InChI=1S/C9H18N2S.ClH/c1-3-11(4-2)7-5-6-8-12-9-10;/h3-8H2,1-2H3;1H |
| InChIKey | FMPGTAMKTGKGHE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylamino)butyl thiocyanate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)butyl thiocyanate;hydrochloride?
The IUPAC name of 4-(diethylamino)butyl thiocyanate;hydrochloride (CID 45263076) is 4-(diethylamino)butyl thiocyanate;hydrochloride.
What is the SMILES notation for 4-(diethylamino)butyl thiocyanate;hydrochloride?
The canonical SMILES for 4-(diethylamino)butyl thiocyanate;hydrochloride is CCN(CC)CCCCSC#N.Cl.
What is the InChIKey of 4-(diethylamino)butyl thiocyanate;hydrochloride?
The InChIKey is FMPGTAMKTGKGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S.ClH/c1-3-11(4-2)7-5-6-8-12-9-10;/h3-8H2,1-2H3;1H.
What are the key properties of 4-(diethylamino)butyl thiocyanate;hydrochloride?
4-(diethylamino)butyl thiocyanate;hydrochloride has a molecular weight of 222.78 g/mol, XLogP of 2.74, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)butyl thiocyanate;hydrochloride is sourced from PubChem (CID 45263076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).