C11H14ClN5S — CID 45263083
2-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride (PubChem CID 45263083) has the molecular formula C11H14ClN5S and a molecular weight of 283.79 g/mol. Its IUPAC name is 2-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride.
| Compound Name | 2-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 45263083 |
| Molecular Formula | C11H14ClN5S |
| Molecular Weight | 283.79 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-[5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cc1cc(C)cc(-c2nnc(N=C(N)N)s2)c1.Cl |
| InChI | InChI=1S/C11H13N5S.ClH/c1-6-3-7(2)5-8(4-6)9-15-16-11(17-9)14-10(12)13;/h3-5H,1-2H3,(H4,12,13,14,16);1H |
| InChIKey | KKXQVWAJWLJODJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.79 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|